C27H30F6O4 — CID 139743594
pentyl 3-[1,1,1,3,3,3-hexafluoro-2-(4-pentoxycarbonylphenyl)propan-2-yl]benzoate (PubChem CID 139743594) has the molecular formula C27H30F6O4 and a molecular weight of 532.52 g/mol. Its IUPAC name is pentyl 3-[1,1,1,3,3,3-hexafluoro-2-(4-pentoxycarbonylphenyl)propan-2-yl]benzoate.
| Compound Name | pentyl 3-[1,1,1,3,3,3-hexafluoro-2-(4-pentoxycarbonylphenyl)propan-2-yl]benzoate |
|---|---|
| PubChem CID | 139743594 |
| Molecular Formula | C27H30F6O4 |
| Molecular Weight | 532.52 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | pentyl 3-[1,1,1,3,3,3-hexafluoro-2-(4-pentoxycarbonylphenyl)propan-2-yl]benzoate |
| SMILES | CCCCCOC(=O)c1ccc(C(c2cccc(C(=O)OCCCCC)c2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H30F6O4/c1-3-5-7-16-36-23(34)19-12-14-21(15-13-19)25(26(28,29)30,27(31,32)33)22-11-9-10-20(18-22)24(35)37-17-8-6-4-2/h9-15,18H,3-8,16-17H2,1-2H3 |
| InChIKey | FQYQYXFVEWCCIQ-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.52 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|