C39H34F6N4O6 — CID 139771821
2-(4-amino-3-butoxyphenyl)-5-[2-[2-(4-amino-3-butoxyphenyl)-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]isoindole-1,3-dione (PubChem CID 139771821) has the molecular formula C39H34F6N4O6 and a molecular weight of 768.71 g/mol. Its IUPAC name is 2-(4-amino-3-butoxyphenyl)-5-[2-[2-(4-amino-3-butoxyphenyl)-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-(4-amino-3-butoxyphenyl)-5-[2-[2-(4-amino-3-butoxyphenyl)-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139771821 |
| Molecular Formula | C39H34F6N4O6 |
| Molecular Weight | 768.71 g/mol |
| Exact Mass | 768.24 |
| IUPAC Name | 2-(4-amino-3-butoxyphenyl)-5-[2-[2-(4-amino-3-butoxyphenyl)-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]isoindole-1,3-dione |
| SMILES | CCCCOc1cc(N2C(=O)c3ccc(C(c4ccc5c(c4)C(=O)N(c4ccc(N)c(OCCCC)c4)C5=O)(C(F)(F)F)C(F)(F)F)cc3C2=O)ccc1N |
| InChI | InChI=1S/C39H34F6N4O6/c1-3-5-15-54-31-19-23(9-13-29(31)46)48-33(50)25-11-7-21(17-27(25)35(48)52)37(38(40,41)42,39(43,44)45)22-8-12-26-28(18-22)36(53)49(34(26)51)24-10-14-30(47)32(20-24)55-16-6-4-2/h7-14,17-20H,3-6,15-16,46-47H2,1-2H3 |
| InChIKey | HCGYNESCOMHDCZ-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 145.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.71 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|