C34H30N4O6 — CID 139771926
2-(3-amino-4-propoxyphenyl)-5-[2-(3-amino-4-propoxyphenyl)-1,3-dioxoisoindol-5-yl]isoindole-1,3-dione (PubChem CID 139771926) has the molecular formula C34H30N4O6 and a molecular weight of 590.64 g/mol. Its IUPAC name is 2-(3-amino-4-propoxyphenyl)-5-[2-(3-amino-4-propoxyphenyl)-1,3-dioxoisoindol-5-yl]isoindole-1,3-dione.
| Compound Name | 2-(3-amino-4-propoxyphenyl)-5-[2-(3-amino-4-propoxyphenyl)-1,3-dioxoisoindol-5-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139771926 |
| Molecular Formula | C34H30N4O6 |
| Molecular Weight | 590.64 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | 2-(3-amino-4-propoxyphenyl)-5-[2-(3-amino-4-propoxyphenyl)-1,3-dioxoisoindol-5-yl]isoindole-1,3-dione |
| SMILES | CCCOc1ccc(N2C(=O)c3ccc(-c4ccc5c(c4)C(=O)N(c4ccc(OCCC)c(N)c4)C5=O)cc3C2=O)cc1N |
| InChI | InChI=1S/C34H30N4O6/c1-3-13-43-29-11-7-21(17-27(29)35)37-31(39)23-9-5-19(15-25(23)33(37)41)20-6-10-24-26(16-20)34(42)38(32(24)40)22-8-12-30(28(36)18-22)44-14-4-2/h5-12,15-18H,3-4,13-14,35-36H2,1-2H3 |
| InChIKey | LNLRFGYYKYMGLV-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 145.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.64 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|