C42H28N2O12 — CID 163576931
4-[2-[4-[5-(4-carboxy-3-ethoxycarbonylphenyl)-1,3-dioxoisoindol-2-yl]phenyl]-1,3-dioxoisoindol-5-yl]-2-ethoxycarbonylbenzoic acid (PubChem CID 163576931) has the molecular formula C42H28N2O12 and a molecular weight of 752.69 g/mol. Its IUPAC name is 4-[2-[4-[5-(4-carboxy-3-ethoxycarbonylphenyl)-1,3-dioxoisoindol-2-yl]phenyl]-1,3-dioxoisoindol-5-yl]-2-ethoxycarbonylbenzoic acid.
| Compound Name | 4-[2-[4-[5-(4-carboxy-3-ethoxycarbonylphenyl)-1,3-dioxoisoindol-2-yl]phenyl]-1,3-dioxoisoindol-5-yl]-2-ethoxycarbonylbenzoic acid |
|---|---|
| PubChem CID | 163576931 |
| Molecular Formula | C42H28N2O12 |
| Molecular Weight | 752.69 g/mol |
| Exact Mass | 752.16 |
| IUPAC Name | 4-[2-[4-[5-(4-carboxy-3-ethoxycarbonylphenyl)-1,3-dioxoisoindol-2-yl]phenyl]-1,3-dioxoisoindol-5-yl]-2-ethoxycarbonylbenzoic acid |
| SMILES | CCOC(=O)c1cc(-c2ccc3c(c2)C(=O)N(c2ccc(N4C(=O)c5ccc(-c6ccc(C(=O)O)c(C(=O)OCC)c6)cc5C4=O)cc2)C3=O)ccc1C(=O)O |
| InChI | InChI=1S/C42H28N2O12/c1-3-55-41(53)33-19-23(7-15-29(33)39(49)50)21-5-13-27-31(17-21)37(47)43(35(27)45)25-9-11-26(12-10-25)44-36(46)28-14-6-22(18-32(28)38(44)48)24-8-16-30(40(51)52)34(20-24)42(54)56-4-2/h5-20H,3-4H2,1-2H3,(H,49,50)(H,51,52) |
| InChIKey | GEHHGBAOGJSBMR-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 201.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.69 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|