C18H13NO6 — CID 164706225
2-methoxycarbonyl-5-(2-methyl-1,3-dioxoisoindol-5-yl)benzoic acid (PubChem CID 164706225) has the molecular formula C18H13NO6 and a molecular weight of 339.30 g/mol. Its IUPAC name is 2-methoxycarbonyl-5-(2-methyl-1,3-dioxoisoindol-5-yl)benzoic acid.
| Compound Name | 2-methoxycarbonyl-5-(2-methyl-1,3-dioxoisoindol-5-yl)benzoic acid |
|---|---|
| PubChem CID | 164706225 |
| Molecular Formula | C18H13NO6 |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 2-methoxycarbonyl-5-(2-methyl-1,3-dioxoisoindol-5-yl)benzoic acid |
| SMILES | COC(=O)c1ccc(-c2ccc3c(c2)C(=O)N(C)C3=O)cc1C(=O)O |
| InChI | InChI=1S/C18H13NO6/c1-19-15(20)11-5-3-9(7-13(11)16(19)21)10-4-6-12(18(24)25-2)14(8-10)17(22)23/h3-8H,1-2H3,(H,22,23) |
| InChIKey | LTRYCMMALIZRGY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|