C46H30N4O4 — CID 171043367
5-(4-aminophenyl)-2-[4-[4-[3-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]phenyl]phenyl]phenyl]isoindole-1,3-dione (PubChem CID 171043367) has the molecular formula C46H30N4O4 and a molecular weight of 702.77 g/mol. Its IUPAC name is 5-(4-aminophenyl)-2-[4-[4-[3-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]phenyl]phenyl]phenyl]isoindole-1,3-dione.
| Compound Name | 5-(4-aminophenyl)-2-[4-[4-[3-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]phenyl]phenyl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 171043367 |
| Molecular Formula | C46H30N4O4 |
| Molecular Weight | 702.77 g/mol |
| Exact Mass | 702.23 |
| IUPAC Name | 5-(4-aminophenyl)-2-[4-[4-[3-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]phenyl]phenyl]phenyl]isoindole-1,3-dione |
| SMILES | Nc1ccc(-c2ccc3c(c2)C(=O)N(c2ccc(-c4ccc(-c5cccc(N6C(=O)c7ccc(-c8ccc(N)cc8)cc7C6=O)c5)cc4)cc2)C3=O)cc1 |
| InChI | InChI=1S/C46H30N4O4/c47-35-16-8-30(9-17-35)33-14-22-39-41(25-33)45(53)49(43(39)51)37-20-12-28(13-21-37)27-4-6-29(7-5-27)32-2-1-3-38(24-32)50-44(52)40-23-15-34(26-42(40)46(50)54)31-10-18-36(48)19-11-31/h1-26H,47-48H2 |
| InChIKey | IXUQZVHEWDKDJX-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.77 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|