C40H26N4O4 — CID 171043216
5-(4-aminophenyl)-2-[2-[2-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]phenyl]phenyl]isoindole-1,3-dione (PubChem CID 171043216) has the molecular formula C40H26N4O4 and a molecular weight of 626.67 g/mol. Its IUPAC name is 5-(4-aminophenyl)-2-[2-[2-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]phenyl]phenyl]isoindole-1,3-dione.
| Compound Name | 5-(4-aminophenyl)-2-[2-[2-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]phenyl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 171043216 |
| Molecular Formula | C40H26N4O4 |
| Molecular Weight | 626.67 g/mol |
| Exact Mass | 626.20 |
| IUPAC Name | 5-(4-aminophenyl)-2-[2-[2-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]phenyl]phenyl]isoindole-1,3-dione |
| SMILES | Nc1ccc(-c2ccc3c(c2)C(=O)N(c2ccccc2-c2ccccc2N2C(=O)c4ccc(-c5ccc(N)cc5)cc4C2=O)C3=O)cc1 |
| InChI | InChI=1S/C40H26N4O4/c41-27-15-9-23(10-16-27)25-13-19-31-33(21-25)39(47)43(37(31)45)35-7-3-1-5-29(35)30-6-2-4-8-36(30)44-38(46)32-20-14-26(22-34(32)40(44)48)24-11-17-28(42)18-12-24/h1-22H,41-42H2 |
| InChIKey | NJAJWESROUVQKL-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.67 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|