C14H12N2O3 — CID 45045681
2-(2-aminophenyl)isoindole-1,3-dione;hydrate (PubChem CID 45045681) has the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is 2-(2-aminophenyl)isoindole-1,3-dione;hydrate.
| Compound Name | 2-(2-aminophenyl)isoindole-1,3-dione;hydrate |
|---|---|
| PubChem CID | 45045681 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 2-(2-aminophenyl)isoindole-1,3-dione;hydrate |
| SMILES | Nc1ccccc1N1C(=O)c2ccccc2C1=O.O |
| InChI | InChI=1S/C14H10N2O2.H2O/c15-11-7-3-4-8-12(11)16-13(17)9-5-1-2-6-10(9)14(16)18;/h1-8H,15H2;1H2 |
| InChIKey | ANINSDXPPGIZFS-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|