C20H20N2O4 — CID 23072378
3-(2-aminophenyl)-8-hydroxy-3-azabicyclo[9.4.0]pentadeca-1(15),11,13-triene-2,4,10-trione (PubChem CID 23072378) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is 3-(2-aminophenyl)-8-hydroxy-3-azabicyclo[9.4.0]pentadeca-1(15),11,13-triene-2,4,10-trione.
| Compound Name | 3-(2-aminophenyl)-8-hydroxy-3-azabicyclo[9.4.0]pentadeca-1(15),11,13-triene-2,4,10-trione |
|---|---|
| PubChem CID | 23072378 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 3-(2-aminophenyl)-8-hydroxy-3-azabicyclo[9.4.0]pentadeca-1(15),11,13-triene-2,4,10-trione |
| SMILES | Nc1ccccc1N1C(=O)CCCC(O)CC(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H20N2O4/c21-16-9-3-4-10-17(16)22-19(25)11-5-6-13(23)12-18(24)14-7-1-2-8-15(14)20(22)26/h1-4,7-10,13,23H,5-6,11-12,21H2 |
| InChIKey | MQOHXMMDJSIQHQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|