C20H11N3O4 — CID 126549663
6-(2-aminophenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 126549663) has the molecular formula C20H11N3O4 and a molecular weight of 357.33 g/mol. Its IUPAC name is 6-(2-aminophenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6-(2-aminophenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 126549663 |
| Molecular Formula | C20H11N3O4 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 6-(2-aminophenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | Nc1ccccc1N1C(=O)c2ccc3c4c(ccc(c24)C1=O)C(=O)NC3=O |
| InChI | InChI=1S/C20H11N3O4/c21-13-3-1-2-4-14(13)23-19(26)11-7-5-9-15-10(18(25)22-17(9)24)6-8-12(16(11)15)20(23)27/h1-8H,21H2,(H,22,24,25) |
| InChIKey | POWOPNYQGHZJPB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|