C40H26N4O12S — CID 171043243
5-(4-aminophenyl)-2-[4-[4-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]-2,3,6-trihydroxyphenyl]sulfonyl-2,3,5-trihydroxyphenyl]isoindole-1,3-dione (PubChem CID 171043243) has the molecular formula C40H26N4O12S and a molecular weight of 786.73 g/mol. Its IUPAC name is 5-(4-aminophenyl)-2-[4-[4-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]-2,3,6-trihydroxyphenyl]sulfonyl-2,3,5-trihydroxyphenyl]isoindole-1,3-dione.
| Compound Name | 5-(4-aminophenyl)-2-[4-[4-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]-2,3,6-trihydroxyphenyl]sulfonyl-2,3,5-trihydroxyphenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 171043243 |
| Molecular Formula | C40H26N4O12S |
| Molecular Weight | 786.73 g/mol |
| Exact Mass | 786.13 |
| IUPAC Name | 5-(4-aminophenyl)-2-[4-[4-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]-2,3,6-trihydroxyphenyl]sulfonyl-2,3,5-trihydroxyphenyl]isoindole-1,3-dione |
| SMILES | Nc1ccc(-c2ccc3c(c2)C(=O)N(c2cc(O)c(S(=O)(=O)c4c(O)cc(N5C(=O)c6ccc(-c7ccc(N)cc7)cc6C5=O)c(O)c4O)c(O)c2O)C3=O)cc1 |
| InChI | InChI=1S/C40H26N4O12S/c41-21-7-1-17(2-8-21)19-5-11-23-25(13-19)39(53)43(37(23)51)27-15-29(45)35(33(49)31(27)47)57(55,56)36-30(46)16-28(32(48)34(36)50)44-38(52)24-12-6-20(14-26(24)40(44)54)18-3-9-22(42)10-4-18/h1-16,45-50H,41-42H2 |
| InChIKey | JKXNIPILHNGCHB-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 282.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.73 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|