C40H24N6O6 — CID 171043439
5-(4-aminophenyl)-2-[4-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]-2,5-bis(1,3-oxazol-2-yl)phenyl]isoindole-1,3-dione (PubChem CID 171043439) has the molecular formula C40H24N6O6 and a molecular weight of 684.67 g/mol. Its IUPAC name is 5-(4-aminophenyl)-2-[4-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]-2,5-bis(1,3-oxazol-2-yl)phenyl]isoindole-1,3-dione.
| Compound Name | 5-(4-aminophenyl)-2-[4-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]-2,5-bis(1,3-oxazol-2-yl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 171043439 |
| Molecular Formula | C40H24N6O6 |
| Molecular Weight | 684.67 g/mol |
| Exact Mass | 684.18 |
| IUPAC Name | 5-(4-aminophenyl)-2-[4-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]-2,5-bis(1,3-oxazol-2-yl)phenyl]isoindole-1,3-dione |
| SMILES | Nc1ccc(-c2ccc3c(c2)C(=O)N(c2cc(-c4ncco4)c(N4C(=O)c5ccc(-c6ccc(N)cc6)cc5C4=O)cc2-c2ncco2)C3=O)cc1 |
| InChI | InChI=1S/C40H24N6O6/c41-25-7-1-21(2-8-25)23-5-11-27-29(17-23)39(49)45(37(27)47)33-19-32(36-44-14-16-52-36)34(20-31(33)35-43-13-15-51-35)46-38(48)28-12-6-24(18-30(28)40(46)50)22-3-9-26(42)10-4-22/h1-20H,41-42H2 |
| InChIKey | HXBNQIHXVXOSJB-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 178.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.67 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|