C35H19I4N3O4 — CID 171043264
5-(4-aminophenyl)-2-[4-[5-(4-aminophenyl)-1,3-dioxoinden-2-yl]-2,3,5,6-tetraiodophenyl]isoindole-1,3-dione (PubChem CID 171043264) has the molecular formula C35H19I4N3O4 and a molecular weight of 1053.17 g/mol. Its IUPAC name is 5-(4-aminophenyl)-2-[4-[5-(4-aminophenyl)-1,3-dioxoinden-2-yl]-2,3,5,6-tetraiodophenyl]isoindole-1,3-dione.
| Compound Name | 5-(4-aminophenyl)-2-[4-[5-(4-aminophenyl)-1,3-dioxoinden-2-yl]-2,3,5,6-tetraiodophenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 171043264 |
| Molecular Formula | C35H19I4N3O4 |
| Molecular Weight | 1053.17 g/mol |
| Exact Mass | 1052.76 |
| IUPAC Name | 5-(4-aminophenyl)-2-[4-[5-(4-aminophenyl)-1,3-dioxoinden-2-yl]-2,3,5,6-tetraiodophenyl]isoindole-1,3-dione |
| SMILES | Nc1ccc(-c2ccc3c(c2)C(=O)C(c2c(I)c(I)c(N4C(=O)c5ccc(-c6ccc(N)cc6)cc5C4=O)c(I)c2I)C3=O)cc1 |
| InChI | InChI=1S/C35H19I4N3O4/c36-27-25(26-32(43)21-11-5-17(13-23(21)33(26)44)15-1-7-19(40)8-2-15)28(37)30(39)31(29(27)38)42-34(45)22-12-6-18(14-24(22)35(42)46)16-3-9-20(41)10-4-16/h1-14,26H,40-41H2 |
| InChIKey | KLECMHVVDGRWPW-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1053.17 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|