C40H24Cl2N4O6S — CID 171043271
5-(4-aminophenyl)-2-[4-[4-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]-2-chlorophenyl]sulfonyl-3-chlorophenyl]isoindole-1,3-dione (PubChem CID 171043271) has the molecular formula C40H24Cl2N4O6S and a molecular weight of 759.63 g/mol. Its IUPAC name is 5-(4-aminophenyl)-2-[4-[4-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]-2-chlorophenyl]sulfonyl-3-chlorophenyl]isoindole-1,3-dione.
| Compound Name | 5-(4-aminophenyl)-2-[4-[4-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]-2-chlorophenyl]sulfonyl-3-chlorophenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 171043271 |
| Molecular Formula | C40H24Cl2N4O6S |
| Molecular Weight | 759.63 g/mol |
| Exact Mass | 758.08 |
| IUPAC Name | 5-(4-aminophenyl)-2-[4-[4-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]-2-chlorophenyl]sulfonyl-3-chlorophenyl]isoindole-1,3-dione |
| SMILES | Nc1ccc(-c2ccc3c(c2)C(=O)N(c2ccc(S(=O)(=O)c4ccc(N5C(=O)c6ccc(-c7ccc(N)cc7)cc6C5=O)cc4Cl)c(Cl)c2)C3=O)cc1 |
| InChI | InChI=1S/C40H24Cl2N4O6S/c41-33-19-27(45-37(47)29-13-5-23(17-31(29)39(45)49)21-1-7-25(43)8-2-21)11-15-35(33)53(51,52)36-16-12-28(20-34(36)42)46-38(48)30-14-6-24(18-32(30)40(46)50)22-3-9-26(44)10-4-22/h1-20H,43-44H2 |
| InChIKey | XBMCUJBAUUIKQF-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 160.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.63 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|