C14H8Cl2N2O2 — CID 154274097
2-(4-aminophenyl)-4,7-dichloroisoindole-1,3-dione (PubChem CID 154274097) has the molecular formula C14H8Cl2N2O2 and a molecular weight of 307.14 g/mol. Its IUPAC name is 2-(4-aminophenyl)-4,7-dichloroisoindole-1,3-dione.
| Compound Name | 2-(4-aminophenyl)-4,7-dichloroisoindole-1,3-dione |
|---|---|
| PubChem CID | 154274097 |
| Molecular Formula | C14H8Cl2N2O2 |
| Molecular Weight | 307.14 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | 2-(4-aminophenyl)-4,7-dichloroisoindole-1,3-dione |
| SMILES | Nc1ccc(N2C(=O)c3c(Cl)ccc(Cl)c3C2=O)cc1 |
| InChI | InChI=1S/C14H8Cl2N2O2/c15-9-5-6-10(16)12-11(9)13(19)18(14(12)20)8-3-1-7(17)2-4-8/h1-6H,17H2 |
| InChIKey | NPQZGLCYEDPVHK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.14 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|