C24H24N2O2S2 — CID 102272915
1-(4-aminophenyl)-3,4-bis(2,4,5-trimethylthiophen-3-yl)pyrrole-2,5-dione (PubChem CID 102272915) has the molecular formula C24H24N2O2S2 and a molecular weight of 436.60 g/mol. Its IUPAC name is 1-(4-aminophenyl)-3,4-bis(2,4,5-trimethylthiophen-3-yl)pyrrole-2,5-dione.
| Compound Name | 1-(4-aminophenyl)-3,4-bis(2,4,5-trimethylthiophen-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 102272915 |
| Molecular Formula | C24H24N2O2S2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 1-(4-aminophenyl)-3,4-bis(2,4,5-trimethylthiophen-3-yl)pyrrole-2,5-dione |
| SMILES | Cc1sc(C)c(C2=C(c3c(C)sc(C)c3C)C(=O)N(c3ccc(N)cc3)C2=O)c1C |
| InChI | InChI=1S/C24H24N2O2S2/c1-11-13(3)29-15(5)19(11)21-22(20-12(2)14(4)30-16(20)6)24(28)26(23(21)27)18-9-7-17(25)8-10-18/h7-10H,25H2,1-6H3 |
| InChIKey | SFEASDJCQKPXLP-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|