C37H32N2O3S2 — CID 102498415
1-[9-(4-methoxyphenyl)carbazol-1-yl]-3,4-bis(2,4,5-trimethylthiophen-3-yl)pyrrole-2,5-dione (PubChem CID 102498415) has the molecular formula C37H32N2O3S2 and a molecular weight of 616.81 g/mol. Its IUPAC name is 1-[9-(4-methoxyphenyl)carbazol-1-yl]-3,4-bis(2,4,5-trimethylthiophen-3-yl)pyrrole-2,5-dione.
| Compound Name | 1-[9-(4-methoxyphenyl)carbazol-1-yl]-3,4-bis(2,4,5-trimethylthiophen-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 102498415 |
| Molecular Formula | C37H32N2O3S2 |
| Molecular Weight | 616.81 g/mol |
| Exact Mass | 616.19 |
| IUPAC Name | 1-[9-(4-methoxyphenyl)carbazol-1-yl]-3,4-bis(2,4,5-trimethylthiophen-3-yl)pyrrole-2,5-dione |
| SMILES | COc1ccc(-n2c3ccccc3c3cccc(N4C(=O)C(c5c(C)sc(C)c5C)=C(c5c(C)sc(C)c5C)C4=O)c32)cc1 |
| InChI | InChI=1S/C37H32N2O3S2/c1-19-21(3)43-23(5)31(19)33-34(32-20(2)22(4)44-24(32)6)37(41)39(36(33)40)30-14-10-12-28-27-11-8-9-13-29(27)38(35(28)30)25-15-17-26(42-7)18-16-25/h8-18H,1-7H3 |
| InChIKey | ISXGJHXFDBRHEQ-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.81 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|