C37H32N2O2S2 — CID 102498412
1-(9-benzylcarbazol-1-yl)-3,4-bis(2,4,5-trimethylthiophen-3-yl)pyrrole-2,5-dione (PubChem CID 102498412) has the molecular formula C37H32N2O2S2 and a molecular weight of 600.81 g/mol. Its IUPAC name is 1-(9-benzylcarbazol-1-yl)-3,4-bis(2,4,5-trimethylthiophen-3-yl)pyrrole-2,5-dione.
| Compound Name | 1-(9-benzylcarbazol-1-yl)-3,4-bis(2,4,5-trimethylthiophen-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 102498412 |
| Molecular Formula | C37H32N2O2S2 |
| Molecular Weight | 600.81 g/mol |
| Exact Mass | 600.19 |
| IUPAC Name | 1-(9-benzylcarbazol-1-yl)-3,4-bis(2,4,5-trimethylthiophen-3-yl)pyrrole-2,5-dione |
| SMILES | Cc1sc(C)c(C2=C(c3c(C)sc(C)c3C)C(=O)N(c3cccc4c5ccccc5n(Cc5ccccc5)c34)C2=O)c1C |
| InChI | InChI=1S/C37H32N2O2S2/c1-20-22(3)42-24(5)31(20)33-34(32-21(2)23(4)43-25(32)6)37(41)39(36(33)40)30-18-12-16-28-27-15-10-11-17-29(27)38(35(28)30)19-26-13-8-7-9-14-26/h7-18H,19H2,1-6H3 |
| InChIKey | KYJSSSSNBYDCBP-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.81 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|