C38H41N3O2 — CID 11250062
1-benzyl-3-(1-hexyl-2-methylindol-3-yl)-4-(2-methyl-1-propylindol-3-yl)pyrrole-2,5-dione (PubChem CID 11250062) has the molecular formula C38H41N3O2 and a molecular weight of 571.77 g/mol. Its IUPAC name is 1-benzyl-3-(1-hexyl-2-methylindol-3-yl)-4-(2-methyl-1-propylindol-3-yl)pyrrole-2,5-dione.
| Compound Name | 1-benzyl-3-(1-hexyl-2-methylindol-3-yl)-4-(2-methyl-1-propylindol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 11250062 |
| Molecular Formula | C38H41N3O2 |
| Molecular Weight | 571.77 g/mol |
| Exact Mass | 571.32 |
| IUPAC Name | 1-benzyl-3-(1-hexyl-2-methylindol-3-yl)-4-(2-methyl-1-propylindol-3-yl)pyrrole-2,5-dione |
| SMILES | CCCCCCn1c(C)c(C2=C(c3c(C)n(CCC)c4ccccc34)C(=O)N(Cc3ccccc3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C38H41N3O2/c1-5-7-8-16-24-40-27(4)34(30-20-13-15-22-32(30)40)36-35(37(42)41(38(36)43)25-28-17-10-9-11-18-28)33-26(3)39(23-6-2)31-21-14-12-19-29(31)33/h9-15,17-22H,5-8,16,23-25H2,1-4H3 |
| InChIKey | OGBOLWIXRBXHEG-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 47.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.77 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|