C31H27N3O2 — CID 101396833
1-benzyl-3,4-bis(1,2-dimethylindol-3-yl)pyrrole-2,5-dione (PubChem CID 101396833) has the molecular formula C31H27N3O2 and a molecular weight of 473.58 g/mol. Its IUPAC name is 1-benzyl-3,4-bis(1,2-dimethylindol-3-yl)pyrrole-2,5-dione.
| Compound Name | 1-benzyl-3,4-bis(1,2-dimethylindol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 101396833 |
| Molecular Formula | C31H27N3O2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | 1-benzyl-3,4-bis(1,2-dimethylindol-3-yl)pyrrole-2,5-dione |
| SMILES | Cc1c(C2=C(c3c(C)n(C)c4ccccc34)C(=O)N(Cc3ccccc3)C2=O)c2ccccc2n1C |
| InChI | InChI=1S/C31H27N3O2/c1-19-26(22-14-8-10-16-24(22)32(19)3)28-29(27-20(2)33(4)25-17-11-9-15-23(25)27)31(36)34(30(28)35)18-21-12-6-5-7-13-21/h5-17H,18H2,1-4H3 |
| InChIKey | GNSIWPXWOIEAHS-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 47.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|