C30H25ClN2O2 — CID 142758683
3-(2-chloro-1-methylindol-3-yl)-4-[(E)-2-(4-methylphenyl)ethenyl]-1-(2-phenylethyl)pyrrole-2,5-dione (PubChem CID 142758683) has the molecular formula C30H25ClN2O2 and a molecular weight of 481.00 g/mol. Its IUPAC name is 3-(2-chloro-1-methylindol-3-yl)-4-[(E)-2-(4-methylphenyl)ethenyl]-1-(2-phenylethyl)pyrrole-2,5-dione.
| Compound Name | 3-(2-chloro-1-methylindol-3-yl)-4-[(E)-2-(4-methylphenyl)ethenyl]-1-(2-phenylethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 142758683 |
| Molecular Formula | C30H25ClN2O2 |
| Molecular Weight | 481.00 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | 3-(2-chloro-1-methylindol-3-yl)-4-[(E)-2-(4-methylphenyl)ethenyl]-1-(2-phenylethyl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(/C=C/C2=C(c3c(Cl)n(C)c4ccccc34)C(=O)N(CCc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C30H25ClN2O2/c1-20-12-14-22(15-13-20)16-17-24-27(26-23-10-6-7-11-25(23)32(2)28(26)31)30(35)33(29(24)34)19-18-21-8-4-3-5-9-21/h3-17H,18-19H2,1-2H3/b17-16+ |
| InChIKey | PYGHXTXYPIXAJH-WUKNDPDISA-N |
| XLogP | 6.22 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.00 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|