C19H17ClN2O4S — CID 110584213
4-[2-[3-chloro-4-(4-methylphenyl)-2,5-dioxopyrrol-1-yl]ethyl]benzenesulfonamide (PubChem CID 110584213) has the molecular formula C19H17ClN2O4S and a molecular weight of 404.88 g/mol. Its IUPAC name is 4-[2-[3-chloro-4-(4-methylphenyl)-2,5-dioxopyrrol-1-yl]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[3-chloro-4-(4-methylphenyl)-2,5-dioxopyrrol-1-yl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110584213 |
| Molecular Formula | C19H17ClN2O4S |
| Molecular Weight | 404.88 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 4-[2-[3-chloro-4-(4-methylphenyl)-2,5-dioxopyrrol-1-yl]ethyl]benzenesulfonamide |
| SMILES | Cc1ccc(C2=C(Cl)C(=O)N(CCc3ccc(S(N)(=O)=O)cc3)C2=O)cc1 |
| InChI | InChI=1S/C19H17ClN2O4S/c1-12-2-6-14(7-3-12)16-17(20)19(24)22(18(16)23)11-10-13-4-8-15(9-5-13)27(21,25)26/h2-9H,10-11H2,1H3,(H2,21,25,26) |
| InChIKey | RFIFZGALYVMOHW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.88 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|