C23H25N3O4S — CID 110560001
4-[2-(2,5-dioxo-3-phenyl-4-piperidin-1-ylpyrrol-1-yl)ethyl]benzenesulfonamide (PubChem CID 110560001) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is 4-[2-(2,5-dioxo-3-phenyl-4-piperidin-1-ylpyrrol-1-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-[2-(2,5-dioxo-3-phenyl-4-piperidin-1-ylpyrrol-1-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110560001 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 4-[2-(2,5-dioxo-3-phenyl-4-piperidin-1-ylpyrrol-1-yl)ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCN2C(=O)C(c3ccccc3)=C(N3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C23H25N3O4S/c24-31(29,30)19-11-9-17(10-12-19)13-16-26-22(27)20(18-7-3-1-4-8-18)21(23(26)28)25-14-5-2-6-15-25/h1,3-4,7-12H,2,5-6,13-16H2,(H2,24,29,30) |
| InChIKey | NCOYPFDGANPDFV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|