C24H27N3O4S — CID 110559840
4-[[3-(3,5-dimethylpiperidin-1-yl)-2,5-dioxo-4-phenylpyrrol-1-yl]methyl]benzenesulfonamide (PubChem CID 110559840) has the molecular formula C24H27N3O4S and a molecular weight of 453.56 g/mol. Its IUPAC name is 4-[[3-(3,5-dimethylpiperidin-1-yl)-2,5-dioxo-4-phenylpyrrol-1-yl]methyl]benzenesulfonamide.
| Compound Name | 4-[[3-(3,5-dimethylpiperidin-1-yl)-2,5-dioxo-4-phenylpyrrol-1-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110559840 |
| Molecular Formula | C24H27N3O4S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 4-[[3-(3,5-dimethylpiperidin-1-yl)-2,5-dioxo-4-phenylpyrrol-1-yl]methyl]benzenesulfonamide |
| SMILES | CC1CC(C)CN(C2=C(c3ccccc3)C(=O)N(Cc3ccc(S(N)(=O)=O)cc3)C2=O)C1 |
| InChI | InChI=1S/C24H27N3O4S/c1-16-12-17(2)14-26(13-16)22-21(19-6-4-3-5-7-19)23(28)27(24(22)29)15-18-8-10-20(11-9-18)32(25,30)31/h3-11,16-17H,12-15H2,1-2H3,(H2,25,30,31) |
| InChIKey | SUMXZVUFJUFQDF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|