C20H26N2O2 — CID 110559373
3-(3,5-dimethylpiperidin-1-yl)-4-phenyl-1-propylpyrrole-2,5-dione (PubChem CID 110559373) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 3-(3,5-dimethylpiperidin-1-yl)-4-phenyl-1-propylpyrrole-2,5-dione.
| Compound Name | 3-(3,5-dimethylpiperidin-1-yl)-4-phenyl-1-propylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110559373 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 3-(3,5-dimethylpiperidin-1-yl)-4-phenyl-1-propylpyrrole-2,5-dione |
| SMILES | CCCN1C(=O)C(c2ccccc2)=C(N2CC(C)CC(C)C2)C1=O |
| InChI | InChI=1S/C20H26N2O2/c1-4-10-22-19(23)17(16-8-6-5-7-9-16)18(20(22)24)21-12-14(2)11-15(3)13-21/h5-9,14-15H,4,10-13H2,1-3H3 |
| InChIKey | SKRRGPIGWGDMES-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|