C27H39N3O3 — CID 110563130
N-[4-[4-(3,5-dimethylpiperidin-1-yl)-1-octyl-2,5-dioxopyrrol-3-yl]phenyl]acetamide (PubChem CID 110563130) has the molecular formula C27H39N3O3 and a molecular weight of 453.63 g/mol. Its IUPAC name is N-[4-[4-(3,5-dimethylpiperidin-1-yl)-1-octyl-2,5-dioxopyrrol-3-yl]phenyl]acetamide.
| Compound Name | N-[4-[4-(3,5-dimethylpiperidin-1-yl)-1-octyl-2,5-dioxopyrrol-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 110563130 |
| Molecular Formula | C27H39N3O3 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.30 |
| IUPAC Name | N-[4-[4-(3,5-dimethylpiperidin-1-yl)-1-octyl-2,5-dioxopyrrol-3-yl]phenyl]acetamide |
| SMILES | CCCCCCCCN1C(=O)C(c2ccc(NC(C)=O)cc2)=C(N2CC(C)CC(C)C2)C1=O |
| InChI | InChI=1S/C27H39N3O3/c1-5-6-7-8-9-10-15-30-26(32)24(22-11-13-23(14-12-22)28-21(4)31)25(27(30)33)29-17-19(2)16-20(3)18-29/h11-14,19-20H,5-10,15-18H2,1-4H3,(H,28,31) |
| InChIKey | CHRGTYGYTPLTBB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|