C26H29N3O3 — CID 110562551
N-[4-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-2,5-dioxo-1-pentylpyrrol-3-yl]phenyl]acetamide (PubChem CID 110562551) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is N-[4-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-2,5-dioxo-1-pentylpyrrol-3-yl]phenyl]acetamide.
| Compound Name | N-[4-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-2,5-dioxo-1-pentylpyrrol-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 110562551 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | N-[4-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-2,5-dioxo-1-pentylpyrrol-3-yl]phenyl]acetamide |
| SMILES | CCCCCN1C(=O)C(c2ccc(NC(C)=O)cc2)=C(N2CCc3ccccc3C2)C1=O |
| InChI | InChI=1S/C26H29N3O3/c1-3-4-7-15-29-25(31)23(20-10-12-22(13-11-20)27-18(2)30)24(26(29)32)28-16-14-19-8-5-6-9-21(19)17-28/h5-6,8-13H,3-4,7,14-17H2,1-2H3,(H,27,30) |
| InChIKey | XSFLUOGAICZZOU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|