C22H21ClN2O2 — CID 110569596
3-(4-chlorophenyl)-4-(3,4-dihydro-1H-isoquinolin-2-yl)-1-propylpyrrole-2,5-dione (PubChem CID 110569596) has the molecular formula C22H21ClN2O2 and a molecular weight of 380.88 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-(3,4-dihydro-1H-isoquinolin-2-yl)-1-propylpyrrole-2,5-dione.
| Compound Name | 3-(4-chlorophenyl)-4-(3,4-dihydro-1H-isoquinolin-2-yl)-1-propylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110569596 |
| Molecular Formula | C22H21ClN2O2 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 3-(4-chlorophenyl)-4-(3,4-dihydro-1H-isoquinolin-2-yl)-1-propylpyrrole-2,5-dione |
| SMILES | CCCN1C(=O)C(c2ccc(Cl)cc2)=C(N2CCc3ccccc3C2)C1=O |
| InChI | InChI=1S/C22H21ClN2O2/c1-2-12-25-21(26)19(16-7-9-18(23)10-8-16)20(22(25)27)24-13-11-15-5-3-4-6-17(15)14-24/h3-10H,2,11-14H2,1H3 |
| InChIKey | NVRCGIXNMQESGU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|