C27H24N4O3 — CID 110562439
N-[4-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-2,5-dioxo-1-(pyridin-2-ylmethyl)pyrrol-3-yl]phenyl]acetamide (PubChem CID 110562439) has the molecular formula C27H24N4O3 and a molecular weight of 452.51 g/mol. Its IUPAC name is N-[4-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-2,5-dioxo-1-(pyridin-2-ylmethyl)pyrrol-3-yl]phenyl]acetamide.
| Compound Name | N-[4-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-2,5-dioxo-1-(pyridin-2-ylmethyl)pyrrol-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 110562439 |
| Molecular Formula | C27H24N4O3 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | N-[4-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-2,5-dioxo-1-(pyridin-2-ylmethyl)pyrrol-3-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C2=C(N3CCc4ccccc4C3)C(=O)N(Cc3ccccn3)C2=O)cc1 |
| InChI | InChI=1S/C27H24N4O3/c1-18(32)29-22-11-9-20(10-12-22)24-25(30-15-13-19-6-2-3-7-21(19)16-30)27(34)31(26(24)33)17-23-8-4-5-14-28-23/h2-12,14H,13,15-17H2,1H3,(H,29,32) |
| InChIKey | VFWZDSSMFCPWKE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|