C25H21N3O3 — CID 110556081
3-(2,3-dihydroindol-1-yl)-4-(4-methoxyphenyl)-1-(pyridin-2-ylmethyl)pyrrole-2,5-dione (PubChem CID 110556081) has the molecular formula C25H21N3O3 and a molecular weight of 411.46 g/mol. Its IUPAC name is 3-(2,3-dihydroindol-1-yl)-4-(4-methoxyphenyl)-1-(pyridin-2-ylmethyl)pyrrole-2,5-dione.
| Compound Name | 3-(2,3-dihydroindol-1-yl)-4-(4-methoxyphenyl)-1-(pyridin-2-ylmethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110556081 |
| Molecular Formula | C25H21N3O3 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 3-(2,3-dihydroindol-1-yl)-4-(4-methoxyphenyl)-1-(pyridin-2-ylmethyl)pyrrole-2,5-dione |
| SMILES | COc1ccc(C2=C(N3CCc4ccccc43)C(=O)N(Cc3ccccn3)C2=O)cc1 |
| InChI | InChI=1S/C25H21N3O3/c1-31-20-11-9-18(10-12-20)22-23(27-15-13-17-6-2-3-8-21(17)27)25(30)28(24(22)29)16-19-7-4-5-14-26-19/h2-12,14H,13,15-16H2,1H3 |
| InChIKey | HARRVMGILKDTBS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|