C27H30N2O3 — CID 110556549
1-cyclooctyl-3-(2,3-dihydroindol-1-yl)-4-(4-methoxyphenyl)pyrrole-2,5-dione (PubChem CID 110556549) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is 1-cyclooctyl-3-(2,3-dihydroindol-1-yl)-4-(4-methoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 1-cyclooctyl-3-(2,3-dihydroindol-1-yl)-4-(4-methoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110556549 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | 1-cyclooctyl-3-(2,3-dihydroindol-1-yl)-4-(4-methoxyphenyl)pyrrole-2,5-dione |
| SMILES | COc1ccc(C2=C(N3CCc4ccccc43)C(=O)N(C3CCCCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C27H30N2O3/c1-32-22-15-13-20(14-16-22)24-25(28-18-17-19-9-7-8-12-23(19)28)27(31)29(26(24)30)21-10-5-3-2-4-6-11-21/h7-9,12-16,21H,2-6,10-11,17-18H2,1H3 |
| InChIKey | NLJPFRLSBJZXIM-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|