C29H34N2O3 — CID 110556471
3-(4-benzylpiperidin-1-yl)-1-cyclohexyl-4-(4-methoxyphenyl)pyrrole-2,5-dione (PubChem CID 110556471) has the molecular formula C29H34N2O3 and a molecular weight of 458.60 g/mol. Its IUPAC name is 3-(4-benzylpiperidin-1-yl)-1-cyclohexyl-4-(4-methoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 3-(4-benzylpiperidin-1-yl)-1-cyclohexyl-4-(4-methoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110556471 |
| Molecular Formula | C29H34N2O3 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | 3-(4-benzylpiperidin-1-yl)-1-cyclohexyl-4-(4-methoxyphenyl)pyrrole-2,5-dione |
| SMILES | COc1ccc(C2=C(N3CCC(Cc4ccccc4)CC3)C(=O)N(C3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C29H34N2O3/c1-34-25-14-12-23(13-15-25)26-27(29(33)31(28(26)32)24-10-6-3-7-11-24)30-18-16-22(17-19-30)20-21-8-4-2-5-9-21/h2,4-5,8-9,12-15,22,24H,3,6-7,10-11,16-20H2,1H3 |
| InChIKey | QAPOQPVETQWLEG-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|