C22H23N5O3 — CID 110562700
N-[4-[1-methyl-2,5-dioxo-4-(4-pyridin-2-ylpiperazin-1-yl)pyrrol-3-yl]phenyl]acetamide (PubChem CID 110562700) has the molecular formula C22H23N5O3 and a molecular weight of 405.46 g/mol. Its IUPAC name is N-[4-[1-methyl-2,5-dioxo-4-(4-pyridin-2-ylpiperazin-1-yl)pyrrol-3-yl]phenyl]acetamide.
| Compound Name | N-[4-[1-methyl-2,5-dioxo-4-(4-pyridin-2-ylpiperazin-1-yl)pyrrol-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 110562700 |
| Molecular Formula | C22H23N5O3 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | N-[4-[1-methyl-2,5-dioxo-4-(4-pyridin-2-ylpiperazin-1-yl)pyrrol-3-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C2=C(N3CCN(c4ccccn4)CC3)C(=O)N(C)C2=O)cc1 |
| InChI | InChI=1S/C22H23N5O3/c1-15(28)24-17-8-6-16(7-9-17)19-20(22(30)25(2)21(19)29)27-13-11-26(12-14-27)18-5-3-4-10-23-18/h3-10H,11-14H2,1-2H3,(H,24,28) |
| InChIKey | PBYLZQXWXMCQLA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|