C23H28N4O6 — CID 164628176
oxalic acid;N-[4-[4-(4-pyridin-2-ylpiperazin-1-yl)butanoyl]phenyl]acetamide (PubChem CID 164628176) has the molecular formula C23H28N4O6 and a molecular weight of 456.50 g/mol. Its IUPAC name is oxalic acid;N-[4-[4-(4-pyridin-2-ylpiperazin-1-yl)butanoyl]phenyl]acetamide.
| Compound Name | oxalic acid;N-[4-[4-(4-pyridin-2-ylpiperazin-1-yl)butanoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 164628176 |
| Molecular Formula | C23H28N4O6 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | oxalic acid;N-[4-[4-(4-pyridin-2-ylpiperazin-1-yl)butanoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C(=O)CCCN2CCN(c3ccccn3)CC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H26N4O2.C2H2O4/c1-17(26)23-19-9-7-18(8-10-19)20(27)5-4-12-24-13-15-25(16-14-24)21-6-2-3-11-22-21;3-1(4)2(5)6/h2-3,6-11H,4-5,12-16H2,1H3,(H,23,26);(H,3,4)(H,5,6) |
| InChIKey | LIMCWIAJWFVKMM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 140.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|