C27H40N2O3 — CID 110547175
3-(3,5-dimethylpiperidin-1-yl)-4-(4-ethoxyphenyl)-1-octylpyrrole-2,5-dione (PubChem CID 110547175) has the molecular formula C27H40N2O3 and a molecular weight of 440.63 g/mol. Its IUPAC name is 3-(3,5-dimethylpiperidin-1-yl)-4-(4-ethoxyphenyl)-1-octylpyrrole-2,5-dione.
| Compound Name | 3-(3,5-dimethylpiperidin-1-yl)-4-(4-ethoxyphenyl)-1-octylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110547175 |
| Molecular Formula | C27H40N2O3 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.30 |
| IUPAC Name | 3-(3,5-dimethylpiperidin-1-yl)-4-(4-ethoxyphenyl)-1-octylpyrrole-2,5-dione |
| SMILES | CCCCCCCCN1C(=O)C(c2ccc(OCC)cc2)=C(N2CC(C)CC(C)C2)C1=O |
| InChI | InChI=1S/C27H40N2O3/c1-5-7-8-9-10-11-16-29-26(30)24(22-12-14-23(15-13-22)32-6-2)25(27(29)31)28-18-20(3)17-21(4)19-28/h12-15,20-21H,5-11,16-19H2,1-4H3 |
| InChIKey | APDNSMOXGNEOMO-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|