C18H15FN2O5S — CID 110582922
4-[2-[3-(4-fluorophenyl)-4-hydroxy-2,5-dioxopyrrol-1-yl]ethyl]benzenesulfonamide (PubChem CID 110582922) has the molecular formula C18H15FN2O5S and a molecular weight of 390.39 g/mol. Its IUPAC name is 4-[2-[3-(4-fluorophenyl)-4-hydroxy-2,5-dioxopyrrol-1-yl]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[3-(4-fluorophenyl)-4-hydroxy-2,5-dioxopyrrol-1-yl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110582922 |
| Molecular Formula | C18H15FN2O5S |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 4-[2-[3-(4-fluorophenyl)-4-hydroxy-2,5-dioxopyrrol-1-yl]ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCN2C(=O)C(O)=C(c3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C18H15FN2O5S/c19-13-5-3-12(4-6-13)15-16(22)18(24)21(17(15)23)10-9-11-1-7-14(8-2-11)27(20,25)26/h1-8,22H,9-10H2,(H2,20,25,26) |
| InChIKey | HETCVUWYMFCQFB-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|