C27H25FN2O2 — CID 110600349
3-(2,3-dimethylanilino)-1-[2-(4-fluorophenyl)ethyl]-4-(4-methylphenyl)pyrrole-2,5-dione (PubChem CID 110600349) has the molecular formula C27H25FN2O2 and a molecular weight of 428.51 g/mol. Its IUPAC name is 3-(2,3-dimethylanilino)-1-[2-(4-fluorophenyl)ethyl]-4-(4-methylphenyl)pyrrole-2,5-dione.
| Compound Name | 3-(2,3-dimethylanilino)-1-[2-(4-fluorophenyl)ethyl]-4-(4-methylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110600349 |
| Molecular Formula | C27H25FN2O2 |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 3-(2,3-dimethylanilino)-1-[2-(4-fluorophenyl)ethyl]-4-(4-methylphenyl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(Nc3cccc(C)c3C)C(=O)N(CCc3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C27H25FN2O2/c1-17-7-11-21(12-8-17)24-25(29-23-6-4-5-18(2)19(23)3)27(32)30(26(24)31)16-15-20-9-13-22(28)14-10-20/h4-14,29H,15-16H2,1-3H3 |
| InChIKey | OANXLSOBPKJNMA-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|