C27H25FN2O4 — CID 110600331
3-(3,5-dimethoxyanilino)-1-[2-(4-fluorophenyl)ethyl]-4-(4-methylphenyl)pyrrole-2,5-dione (PubChem CID 110600331) has the molecular formula C27H25FN2O4 and a molecular weight of 460.51 g/mol. Its IUPAC name is 3-(3,5-dimethoxyanilino)-1-[2-(4-fluorophenyl)ethyl]-4-(4-methylphenyl)pyrrole-2,5-dione.
| Compound Name | 3-(3,5-dimethoxyanilino)-1-[2-(4-fluorophenyl)ethyl]-4-(4-methylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110600331 |
| Molecular Formula | C27H25FN2O4 |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 3-(3,5-dimethoxyanilino)-1-[2-(4-fluorophenyl)ethyl]-4-(4-methylphenyl)pyrrole-2,5-dione |
| SMILES | COc1cc(NC2=C(c3ccc(C)cc3)C(=O)N(CCc3ccc(F)cc3)C2=O)cc(OC)c1 |
| InChI | InChI=1S/C27H25FN2O4/c1-17-4-8-19(9-5-17)24-25(29-21-14-22(33-2)16-23(15-21)34-3)27(32)30(26(24)31)13-12-18-6-10-20(28)11-7-18/h4-11,14-16,29H,12-13H2,1-3H3 |
| InChIKey | RMXQYLFZGUHADN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|