C21H21FN2O4 — CID 110586207
3-(3,5-dimethoxyanilino)-4-(4-fluorophenyl)-1-propylpyrrole-2,5-dione (PubChem CID 110586207) has the molecular formula C21H21FN2O4 and a molecular weight of 384.41 g/mol. Its IUPAC name is 3-(3,5-dimethoxyanilino)-4-(4-fluorophenyl)-1-propylpyrrole-2,5-dione.
| Compound Name | 3-(3,5-dimethoxyanilino)-4-(4-fluorophenyl)-1-propylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110586207 |
| Molecular Formula | C21H21FN2O4 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 3-(3,5-dimethoxyanilino)-4-(4-fluorophenyl)-1-propylpyrrole-2,5-dione |
| SMILES | CCCN1C(=O)C(Nc2cc(OC)cc(OC)c2)=C(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C21H21FN2O4/c1-4-9-24-20(25)18(13-5-7-14(22)8-6-13)19(21(24)26)23-15-10-16(27-2)12-17(11-15)28-3/h5-8,10-12,23H,4,9H2,1-3H3 |
| InChIKey | KVQQHPYZPJZFDZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|