C24H19NO5 — CID 163112984
3,4-bis(4-hydroxyphenyl)-1-[2-(4-hydroxyphenyl)ethyl]pyrrole-2,5-dione (PubChem CID 163112984) has the molecular formula C24H19NO5 and a molecular weight of 401.42 g/mol. Its IUPAC name is 3,4-bis(4-hydroxyphenyl)-1-[2-(4-hydroxyphenyl)ethyl]pyrrole-2,5-dione.
| Compound Name | 3,4-bis(4-hydroxyphenyl)-1-[2-(4-hydroxyphenyl)ethyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 163112984 |
| Molecular Formula | C24H19NO5 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 3,4-bis(4-hydroxyphenyl)-1-[2-(4-hydroxyphenyl)ethyl]pyrrole-2,5-dione |
| SMILES | O=C1C(c2ccc(O)cc2)=C(c2ccc(O)cc2)C(=O)N1CCc1ccc(O)cc1 |
| InChI | InChI=1S/C24H19NO5/c26-18-7-1-15(2-8-18)13-14-25-23(29)21(16-3-9-19(27)10-4-16)22(24(25)30)17-5-11-20(28)12-6-17/h1-12,26-28H,13-14H2 |
| InChIKey | REWIMHIVGDGBBY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|