C15H11ClN2O4S2 — CID 110583051
4-[(3-chloro-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl)methyl]benzenesulfonamide (PubChem CID 110583051) has the molecular formula C15H11ClN2O4S2 and a molecular weight of 382.85 g/mol. Its IUPAC name is 4-[(3-chloro-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl)methyl]benzenesulfonamide.
| Compound Name | 4-[(3-chloro-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110583051 |
| Molecular Formula | C15H11ClN2O4S2 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 381.98 |
| IUPAC Name | 4-[(3-chloro-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl)methyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CN2C(=O)C(Cl)=C(c3cccs3)C2=O)cc1 |
| InChI | InChI=1S/C15H11ClN2O4S2/c16-13-12(11-2-1-7-23-11)14(19)18(15(13)20)8-9-3-5-10(6-4-9)24(17,21)22/h1-7H,8H2,(H2,17,21,22) |
| InChIKey | MNMGXJISGJYASU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|