C18H15N3O3S2 — CID 142707215
4-[(7-hydroxy-2-thiophen-2-ylbenzimidazol-1-yl)methyl]benzenesulfonamide (PubChem CID 142707215) has the molecular formula C18H15N3O3S2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 4-[(7-hydroxy-2-thiophen-2-ylbenzimidazol-1-yl)methyl]benzenesulfonamide.
| Compound Name | 4-[(7-hydroxy-2-thiophen-2-ylbenzimidazol-1-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 142707215 |
| Molecular Formula | C18H15N3O3S2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 4-[(7-hydroxy-2-thiophen-2-ylbenzimidazol-1-yl)methyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Cn2c(-c3cccs3)nc3cccc(O)c32)cc1 |
| InChI | InChI=1S/C18H15N3O3S2/c19-26(23,24)13-8-6-12(7-9-13)11-21-17-14(3-1-4-15(17)22)20-18(21)16-5-2-10-25-16/h1-10,22H,11H2,(H2,19,23,24) |
| InChIKey | LAQHHUMXAIEONM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |