C22H22N2S — CID 17000265
1-[(4-butan-2-ylphenyl)methyl]-2-thiophen-2-ylbenzimidazole (PubChem CID 17000265) has the molecular formula C22H22N2S and a molecular weight of 346.50 g/mol. Its IUPAC name is 1-[(4-butan-2-ylphenyl)methyl]-2-thiophen-2-ylbenzimidazole.
| Compound Name | 1-[(4-butan-2-ylphenyl)methyl]-2-thiophen-2-ylbenzimidazole |
|---|---|
| PubChem CID | 17000265 |
| Molecular Formula | C22H22N2S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 1-[(4-butan-2-ylphenyl)methyl]-2-thiophen-2-ylbenzimidazole |
| SMILES | CCC(C)c1ccc(Cn2c(-c3cccs3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C22H22N2S/c1-3-16(2)18-12-10-17(11-13-18)15-24-20-8-5-4-7-19(20)23-22(24)21-9-6-14-25-21/h4-14,16H,3,15H2,1-2H3 |
| InChIKey | MKZYGFCONBOEIB-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |