C24H31N3O — CID 18885134
4-[1-[1-[(4-butan-2-ylphenyl)methyl]benzimidazol-2-yl]ethyl]morpholine (PubChem CID 18885134) has the molecular formula C24H31N3O and a molecular weight of 377.53 g/mol. Its IUPAC name is 4-[1-[1-[(4-butan-2-ylphenyl)methyl]benzimidazol-2-yl]ethyl]morpholine.
| Compound Name | 4-[1-[1-[(4-butan-2-ylphenyl)methyl]benzimidazol-2-yl]ethyl]morpholine |
|---|---|
| PubChem CID | 18885134 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 4-[1-[1-[(4-butan-2-ylphenyl)methyl]benzimidazol-2-yl]ethyl]morpholine |
| SMILES | CCC(C)c1ccc(Cn2c(C(C)N3CCOCC3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C24H31N3O/c1-4-18(2)21-11-9-20(10-12-21)17-27-23-8-6-5-7-22(23)25-24(27)19(3)26-13-15-28-16-14-26/h5-12,18-19H,4,13-17H2,1-3H3 |
| InChIKey | GRRZTFAROMSZOY-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |