C17H14ClN3O4S — CID 1187263
4-[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]benzenesulfonamide (PubChem CID 1187263) has the molecular formula C17H14ClN3O4S and a molecular weight of 391.84 g/mol. Its IUPAC name is 4-[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]benzenesulfonamide.
| Compound Name | 4-[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 1187263 |
| Molecular Formula | C17H14ClN3O4S |
| Molecular Weight | 391.84 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | 4-[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NC2=C(Cl)C(=O)N(Cc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C17H14ClN3O4S/c18-14-15(20-12-6-8-13(9-7-12)26(19,24)25)17(23)21(16(14)22)10-11-4-2-1-3-5-11/h1-9,20H,10H2,(H2,19,24,25) |
| InChIKey | WPKORICEVGOMFZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.84 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|