C25H20Cl2N4O5S — CID 1408256
4-[[[4-chloro-1-[(4-chlorophenyl)methyl]-2,5-dioxopyrrol-3-yl]amino]methyl]-N-(4-sulfamoylphenyl)benzamide (PubChem CID 1408256) has the molecular formula C25H20Cl2N4O5S and a molecular weight of 559.43 g/mol. Its IUPAC name is 4-[[[4-chloro-1-[(4-chlorophenyl)methyl]-2,5-dioxopyrrol-3-yl]amino]methyl]-N-(4-sulfamoylphenyl)benzamide.
| Compound Name | 4-[[[4-chloro-1-[(4-chlorophenyl)methyl]-2,5-dioxopyrrol-3-yl]amino]methyl]-N-(4-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 1408256 |
| Molecular Formula | C25H20Cl2N4O5S |
| Molecular Weight | 559.43 g/mol |
| Exact Mass | 558.05 |
| IUPAC Name | 4-[[[4-chloro-1-[(4-chlorophenyl)methyl]-2,5-dioxopyrrol-3-yl]amino]methyl]-N-(4-sulfamoylphenyl)benzamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2ccc(CNC3=C(Cl)C(=O)N(Cc4ccc(Cl)cc4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C25H20Cl2N4O5S/c26-18-7-3-16(4-8-18)14-31-24(33)21(27)22(25(31)34)29-13-15-1-5-17(6-2-15)23(32)30-19-9-11-20(12-10-19)37(28,35)36/h1-12,29H,13-14H2,(H,30,32)(H2,28,35,36) |
| InChIKey | FLBQZAGSCIHGRZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|