C27H21Cl2N3O5 — CID 1408267
methyl 4-[[4-[[[4-chloro-1-[(4-chlorophenyl)methyl]-2,5-dioxopyrrol-3-yl]amino]methyl]benzoyl]amino]benzoate (PubChem CID 1408267) has the molecular formula C27H21Cl2N3O5 and a molecular weight of 538.39 g/mol. Its IUPAC name is methyl 4-[[4-[[[4-chloro-1-[(4-chlorophenyl)methyl]-2,5-dioxopyrrol-3-yl]amino]methyl]benzoyl]amino]benzoate.
| Compound Name | methyl 4-[[4-[[[4-chloro-1-[(4-chlorophenyl)methyl]-2,5-dioxopyrrol-3-yl]amino]methyl]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 1408267 |
| Molecular Formula | C27H21Cl2N3O5 |
| Molecular Weight | 538.39 g/mol |
| Exact Mass | 537.09 |
| IUPAC Name | methyl 4-[[4-[[[4-chloro-1-[(4-chlorophenyl)methyl]-2,5-dioxopyrrol-3-yl]amino]methyl]benzoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2ccc(CNC3=C(Cl)C(=O)N(Cc4ccc(Cl)cc4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C27H21Cl2N3O5/c1-37-27(36)19-8-12-21(13-9-19)31-24(33)18-6-2-16(3-7-18)14-30-23-22(29)25(34)32(26(23)35)15-17-4-10-20(28)11-5-17/h2-13,30H,14-15H2,1H3,(H,31,33) |
| InChIKey | NFKKSAWXPGSBPF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|