C27H28ClN3O5 — CID 1408062
ethyl 4-[[4-[[(4-chloro-1-cyclohexyl-2,5-dioxopyrrol-3-yl)amino]methyl]benzoyl]amino]benzoate (PubChem CID 1408062) has the molecular formula C27H28ClN3O5 and a molecular weight of 509.99 g/mol. Its IUPAC name is ethyl 4-[[4-[[(4-chloro-1-cyclohexyl-2,5-dioxopyrrol-3-yl)amino]methyl]benzoyl]amino]benzoate.
| Compound Name | ethyl 4-[[4-[[(4-chloro-1-cyclohexyl-2,5-dioxopyrrol-3-yl)amino]methyl]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 1408062 |
| Molecular Formula | C27H28ClN3O5 |
| Molecular Weight | 509.99 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | ethyl 4-[[4-[[(4-chloro-1-cyclohexyl-2,5-dioxopyrrol-3-yl)amino]methyl]benzoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2ccc(CNC3=C(Cl)C(=O)N(C4CCCCC4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C27H28ClN3O5/c1-2-36-27(35)19-12-14-20(15-13-19)30-24(32)18-10-8-17(9-11-18)16-29-23-22(28)25(33)31(26(23)34)21-6-4-3-5-7-21/h8-15,21,29H,2-7,16H2,1H3,(H,30,32) |
| InChIKey | ODMVAOFPUBUPAM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.99 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|