C26H26ClN3O5 — CID 1408081
4-[[(4-chloro-1-cyclohexyl-2,5-dioxopyrrol-3-yl)amino]methyl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)benzamide (PubChem CID 1408081) has the molecular formula C26H26ClN3O5 and a molecular weight of 495.96 g/mol. Its IUPAC name is 4-[[(4-chloro-1-cyclohexyl-2,5-dioxopyrrol-3-yl)amino]methyl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)benzamide.
| Compound Name | 4-[[(4-chloro-1-cyclohexyl-2,5-dioxopyrrol-3-yl)amino]methyl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)benzamide |
|---|---|
| PubChem CID | 1408081 |
| Molecular Formula | C26H26ClN3O5 |
| Molecular Weight | 495.96 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 4-[[(4-chloro-1-cyclohexyl-2,5-dioxopyrrol-3-yl)amino]methyl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)benzamide |
| SMILES | O=C(Nc1ccc2c(c1)OCCO2)c1ccc(CNC2=C(Cl)C(=O)N(C3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C26H26ClN3O5/c27-22-23(26(33)30(25(22)32)19-4-2-1-3-5-19)28-15-16-6-8-17(9-7-16)24(31)29-18-10-11-20-21(14-18)35-13-12-34-20/h6-11,14,19,28H,1-5,12-13,15H2,(H,29,31) |
| InChIKey | QIJWFUUMDRVWNI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.96 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|