C26H27ClN4O4 — CID 1408084
N-(4-acetamidophenyl)-4-[[(4-chloro-1-cyclohexyl-2,5-dioxopyrrol-3-yl)amino]methyl]benzamide (PubChem CID 1408084) has the molecular formula C26H27ClN4O4 and a molecular weight of 494.98 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-4-[[(4-chloro-1-cyclohexyl-2,5-dioxopyrrol-3-yl)amino]methyl]benzamide.
| Compound Name | N-(4-acetamidophenyl)-4-[[(4-chloro-1-cyclohexyl-2,5-dioxopyrrol-3-yl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 1408084 |
| Molecular Formula | C26H27ClN4O4 |
| Molecular Weight | 494.98 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | N-(4-acetamidophenyl)-4-[[(4-chloro-1-cyclohexyl-2,5-dioxopyrrol-3-yl)amino]methyl]benzamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)c2ccc(CNC3=C(Cl)C(=O)N(C4CCCCC4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C26H27ClN4O4/c1-16(32)29-19-11-13-20(14-12-19)30-24(33)18-9-7-17(8-10-18)15-28-23-22(27)25(34)31(26(23)35)21-5-3-2-4-6-21/h7-14,21,28H,2-6,15H2,1H3,(H,29,32)(H,30,33) |
| InChIKey | AYXQFELHHSFXAF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.98 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|